C31H35FO5 — CID 10577520
(2R,3R,4R,5S,6R)-2-but-3-en-2-yloxy-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10577520) has the molecular formula C31H35FO5 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-but-3-en-2-yloxy-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4R,5S,6R)-2-but-3-en-2-yloxy-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10577520 |
| Molecular Formula | C31H35FO5 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-but-3-en-2-yloxy-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=CC(C)O[C@@H]1O[C@H](COCc2ccccc2)[C@H](F)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H35FO5/c1-3-23(2)36-31-30(35-21-26-17-11-6-12-18-26)29(34-20-25-15-9-5-10-16-25)28(32)27(37-31)22-33-19-24-13-7-4-8-14-24/h3-18,23,27-31H,1,19-22H2,2H3/t23?,27-,28+,29+,30-,31-/m1/s1 |
| InChIKey | HWBICSCEQIVUSM-DEFCTHTRSA-N |
| XLogP | 6.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|