C37H39ClO6 — CID 67563296
(2R,3R,4S,5R,6R)-2-(1-chloroprop-2-enoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 67563296) has the molecular formula C37H39ClO6 and a molecular weight of 615.17 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(1-chloroprop-2-enoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-(1-chloroprop-2-enoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 67563296 |
| Molecular Formula | C37H39ClO6 |
| Molecular Weight | 615.17 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(1-chloroprop-2-enoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=CC(Cl)O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H39ClO6/c1-2-33(38)44-37-36(42-26-31-21-13-6-14-22-31)35(41-25-30-19-11-5-12-20-30)34(40-24-29-17-9-4-10-18-29)32(43-37)27-39-23-28-15-7-3-8-16-28/h2-22,32-37H,1,23-27H2/t32-,33?,34-,35+,36-,37-/m1/s1 |
| InChIKey | AHIGPSLHMJMIAM-HTZZROOISA-N |
| XLogP | 7.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.17 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|