C37H43NO6 — CID 70142201
1-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-1-amine (PubChem CID 70142201) has the molecular formula C37H43NO6 and a molecular weight of 597.75 g/mol. Its IUPAC name is 1-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-1-amine.
| Compound Name | 1-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 70142201 |
| Molecular Formula | C37H43NO6 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 1-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-1-amine |
| SMILES | CCC(N)OC1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H43NO6/c1-2-33(38)44-37-36(42-26-31-21-13-6-14-22-31)35(41-25-30-19-11-5-12-20-30)34(40-24-29-17-9-4-10-18-29)32(43-37)27-39-23-28-15-7-3-8-16-28/h3-22,32-37H,2,23-27,38H2,1H3/t32-,33?,34+,35+,36-,37?/m1/s1 |
| InChIKey | APUHQMWBZAXHQP-BISPHACSSA-N |
| XLogP | 6.40 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|