C31H34O7 — CID 101103261
[(2R,3R,4S,5R,6R)-2-[(2S)-but-3-en-2-yl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate (PubChem CID 101103261) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[(2S)-but-3-en-2-yl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[(2S)-but-3-en-2-yl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101103261 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[(2S)-but-3-en-2-yl]oxy-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
| SMILES | C=C[C@H](C)O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H34O7/c1-3-22(2)36-31-29(38-30(33)25-17-11-6-12-18-25)28(35-20-24-15-9-5-10-16-24)27(32)26(37-31)21-34-19-23-13-7-4-8-14-23/h3-18,22,26-29,31-32H,1,19-21H2,2H3/t22-,26+,27+,28-,29+,31+/m0/s1 |
| InChIKey | BHKDPICYGPCNGK-VRUORDSFSA-N |
| XLogP | 4.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|