C35H44O7 — CID 101468827
[(2R,3R,4S,5S,6R)-5-hydroxy-2-octoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate (PubChem CID 101468827) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-5-hydroxy-2-octoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-5-hydroxy-2-octoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101468827 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-5-hydroxy-2-octoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@H](O)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H44O7/c1-2-3-4-5-6-16-23-39-35-33(42-34(37)29-21-14-9-15-22-29)32(40-25-28-19-12-8-13-20-28)31(36)30(41-35)26-38-24-27-17-10-7-11-18-27/h7-15,17-22,30-33,35-36H,2-6,16,23-26H2,1H3/t30-,31+,32+,33-,35-/m1/s1 |
| InChIKey | GCKYELPIUHRQHX-ATFNGGABSA-N |
| XLogP | 6.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|