C22H25Cl3N4O8 — CID 11006380
[(2R,3S,4R,5R)-4-acetyloxy-5-azido-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate (PubChem CID 11006380) has the molecular formula C22H25Cl3N4O8 and a molecular weight of 579.82 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-azido-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-azido-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 11006380 |
| Molecular Formula | C22H25Cl3N4O8 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-azido-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
| SMILES | [H]/N=C(/OC1O[C@H](COCc2ccccc2)[C@@H](OC(=O)CCC(C)=O)[C@H](OC(C)=O)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H25Cl3N4O8/c1-12(30)8-9-16(32)36-18-15(11-33-10-14-6-4-3-5-7-14)35-20(37-21(26)22(23,24)25)17(28-29-27)19(18)34-13(2)31/h3-7,15,17-20,26H,8-11H2,1-2H3/b26-21+/t15-,17-,18-,19-,20?/m1/s1 |
| InChIKey | UNEPPVVUILZLLE-BKXUANLMSA-N |
| XLogP | 4.18 |
| TPSA | 169.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|