C33H40Cl3NO17 — CID 138963209
[(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6S)-4,5-diacetyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 138963209) has the molecular formula C33H40Cl3NO17 and a molecular weight of 829.03 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6S)-4,5-diacetyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6S)-4,5-diacetyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138963209 |
| Molecular Formula | C33H40Cl3NO17 |
| Molecular Weight | 829.03 g/mol |
| Exact Mass | 827.14 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6S)-4,5-diacetyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1OC(COCc2ccccc2)[C@H](O[C@@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H40Cl3NO17/c1-15(38)45-14-23-24(46-16(2)39)26(47-17(3)40)28(49-19(5)42)30(52-23)53-25-22(13-44-12-21-10-8-7-9-11-21)51-31(54-32(37)33(34,35)36)29(50-20(6)43)27(25)48-18(4)41/h7-11,22-31,37H,12-14H2,1-6H3/b37-32+/t22?,23?,24-,25+,26?,27?,28?,29?,30+,31+/m1/s1 |
| InChIKey | OUVBSXJOVBPNNF-HBBXJBCESA-N |
| XLogP | 2.62 |
| TPSA | 227.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.03 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|