C21H24Cl3NO9 — CID 102462249
[(2S,3R,4S,5R)-3,5-diacetyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 102462249) has the molecular formula C21H24Cl3NO9 and a molecular weight of 540.78 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,5-diacetyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R)-3,5-diacetyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102462249 |
| Molecular Formula | C21H24Cl3NO9 |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | [(2S,3R,4S,5R)-3,5-diacetyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H24Cl3NO9/c1-11(26)29-10-15-16(31-12(2)27)17(30-9-14-7-5-4-6-8-14)18(32-13(3)28)19(33-15)34-20(25)21(22,23)24/h4-8,15-19,25H,9-10H2,1-3H3/b25-20+/t15-,16+,17-,18+,19?/m0/s1 |
| InChIKey | HYTVLVZDWTUPII-CXABDHPZSA-N |
| XLogP | 3.09 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|