C25H28Cl3NO6 — CID 146034519
[(3R,4S,6S)-5-methyl-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 146034519) has the molecular formula C25H28Cl3NO6 and a molecular weight of 544.86 g/mol. Its IUPAC name is [(3R,4S,6S)-5-methyl-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-5-methyl-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146034519 |
| Molecular Formula | C25H28Cl3NO6 |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | [(3R,4S,6S)-5-methyl-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1OC(COC(C)=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H28Cl3NO6/c1-16-21(32-13-18-9-5-3-6-10-18)22(33-14-19-11-7-4-8-12-19)20(15-31-17(2)30)34-23(16)35-24(29)25(26,27)28/h3-12,16,20-23,29H,13-15H2,1-2H3/b29-24+/t16?,20?,21-,22-,23-/m0/s1 |
| InChIKey | DZIHYGVXYUWVEG-CYSWKRTBSA-N |
| XLogP | 5.45 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|