C23H26Cl3NO4 — CID 174137753
[(4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 174137753) has the molecular formula C23H26Cl3NO4 and a molecular weight of 486.82 g/mol. Its IUPAC name is [(4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 174137753 |
| Molecular Formula | C23H26Cl3NO4 |
| Molecular Weight | 486.82 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [(4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(C)[C@@H](C)[C@H](OCc2ccccc2)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H26Cl3NO4/c1-15-16(2)30-21(31-22(27)23(24,25)26)20(29-14-18-11-7-4-8-12-18)19(15)28-13-17-9-5-3-6-10-17/h3-12,15-16,19-21,27H,13-14H2,1-2H3/b27-22+/t15-,16?,19+,20?,21?/m1/s1 |
| InChIKey | PLVLXBZOJKGQAQ-XYVQIDBMSA-N |
| XLogP | 5.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.82 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|