C19H22Cl3NO7 — CID 11283076
[(2S,3R,4R,5S)-4-acetyloxy-2-methyl-5-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 11283076) has the molecular formula C19H22Cl3NO7 and a molecular weight of 482.74 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4-acetyloxy-2-methyl-5-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4-acetyloxy-2-methyl-5-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11283076 |
| Molecular Formula | C19H22Cl3NO7 |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [(2S,3R,4R,5S)-4-acetyloxy-2-methyl-5-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H22Cl3NO7/c1-10-14(28-11(2)24)15(29-12(3)25)16(26-9-13-7-5-4-6-8-13)17(27-10)30-18(23)19(20,21)22/h4-8,10,14-17,23H,9H2,1-3H3/b23-18+/t10-,14+,15+,16-,17?/m0/s1 |
| InChIKey | DPIPOKAZRVFVCU-MUVCWURFSA-N |
| XLogP | 3.54 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|