C34H36Cl3NO14 — CID 11061734
[(2S,3S,4R,5R,6S)-5-benzoyloxy-2-methyl-4-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 11061734) has the molecular formula C34H36Cl3NO14 and a molecular weight of 789.01 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-5-benzoyloxy-2-methyl-4-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R,6S)-5-benzoyloxy-2-methyl-4-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11061734 |
| Molecular Formula | C34H36Cl3NO14 |
| Molecular Weight | 789.01 g/mol |
| Exact Mass | 787.12 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-5-benzoyloxy-2-methyl-4-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccccc2)[C@@H](O[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H36Cl3NO14/c1-16-23(46-18(3)39)25(47-19(4)40)27(48-20(5)41)31(44-16)51-26-24(49-29(42)21-12-8-6-9-13-21)17(2)45-32(52-33(38)34(35,36)37)28(26)50-30(43)22-14-10-7-11-15-22/h6-17,23-28,31-32,38H,1-5H3/b38-33+/t16-,17-,23-,24-,25+,26+,27+,28+,31-,32-/m0/s1 |
| InChIKey | NAZZYDHSAKGFIL-WOONJEQCSA-N |
| XLogP | 4.47 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.01 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|