C36H34Cl3NO7 — CID 89005937
[(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 89005937) has the molecular formula C36H34Cl3NO7 and a molecular weight of 699.03 g/mol. Its IUPAC name is [(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 89005937 |
| Molecular Formula | C36H34Cl3NO7 |
| Molecular Weight | 699.03 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | [(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H34Cl3NO7/c37-36(38,39)35(40)47-34-32(46-33(41)28-19-11-4-12-20-28)31(44-23-27-17-9-3-10-18-27)30(43-22-26-15-7-2-8-16-26)29(45-34)24-42-21-25-13-5-1-6-14-25/h1-20,29-32,34,40H,21-24H2/b40-35+/t29?,30-,31-,32?,34-/m1/s1 |
| InChIKey | AHWNPSJPXORJSA-FVFGZXFFSA-N |
| XLogP | 7.69 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.03 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|