C34H38Cl3NO6 — CID 57409611
[(3R,4S,5R,6R)-3-(1-cyclopropylethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 57409611) has the molecular formula C34H38Cl3NO6 and a molecular weight of 663.04 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3-(1-cyclopropylethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5R,6R)-3-(1-cyclopropylethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 57409611 |
| Molecular Formula | C34H38Cl3NO6 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | [(3R,4S,5R,6R)-3-(1-cyclopropylethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(C)C1CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H38Cl3NO6/c1-23(27-17-18-27)42-31-30(41-21-26-15-9-4-10-16-26)29(40-20-25-13-7-3-8-14-25)28(22-39-19-24-11-5-2-6-12-24)43-32(31)44-33(38)34(35,36)37/h2-16,23,27-32,38H,17-22H2,1H3/b38-33+/t23?,28-,29-,30+,31-,32?/m1/s1 |
| InChIKey | TWKMYALRASCTJB-VQBDZSGDSA-N |
| XLogP | 7.65 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|