C27H32O8 — CID 174135255
[(3S,4S,6R)-5-benzoyloxy-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyloxan-2-yl]methyl benzoate (PubChem CID 174135255) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(3S,4S,6R)-5-benzoyloxy-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyloxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4S,6R)-5-benzoyloxy-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 174135255 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [(3S,4S,6R)-5-benzoyloxy-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyloxan-2-yl]methyl benzoate |
| SMILES | COC(=O)CCCO[C@@H]1OC(COC(=O)c2ccccc2)[C@@H](C)[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H32O8/c1-18-19(2)24(35-26(30)21-13-8-5-9-14-21)27(32-16-10-15-23(28)31-3)34-22(18)17-33-25(29)20-11-6-4-7-12-20/h4-9,11-14,18-19,22,24,27H,10,15-17H2,1-3H3/t18-,19-,22?,24?,27+/m0/s1 |
| InChIKey | FNPJICGLWJXIDR-AXOOALDISA-N |
| XLogP | 4.04 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|