C36H50O9 — CID 90429066
[(2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyloxan-3-yl] benzoate (PubChem CID 90429066) has the molecular formula C36H50O9 and a molecular weight of 626.79 g/mol. Its IUPAC name is [(2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyloxan-3-yl] benzoate.
| Compound Name | [(2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 90429066 |
| Molecular Formula | C36H50O9 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | [(2S,4S,5S)-6-ethyl-2-[[(3S,4S,6R)-6-(4-methoxy-4-oxobutoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyloxan-3-yl] benzoate |
| SMILES | CCC1O[C@H](OCC2O[C@@H](OCCCC(=O)OC)C(OCc3ccccc3)[C@@H](C)[C@@H]2C)C(OC(=O)c2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C36H50O9/c1-7-29-23(2)26(5)33(45-34(38)28-17-12-9-13-18-28)36(43-29)42-22-30-24(3)25(4)32(41-21-27-15-10-8-11-16-27)35(44-30)40-20-14-19-31(37)39-6/h8-13,15-18,23-26,29-30,32-33,35-36H,7,14,19-22H2,1-6H3/t23-,24-,25-,26-,29?,30?,32?,33?,35+,36-/m0/s1 |
| InChIKey | VLUBPGJUFFCFIM-OMHITGJMSA-N |
| XLogP | 6.19 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|