C29H40O7 — CID 101024553
methyl 9-[(2S,3S,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]oxynonanoate (PubChem CID 101024553) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is methyl 9-[(2S,3S,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2S,3S,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 101024553 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | methyl 9-[(2S,3S,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H40O7/c1-32-26(31)18-12-4-2-3-5-13-19-33-29-28(35-22-24-16-10-7-11-17-24)27(25(20-30)36-29)34-21-23-14-8-6-9-15-23/h6-11,14-17,25,27-30H,2-5,12-13,18-22H2,1H3/t25-,27-,28+,29+/m1/s1 |
| InChIKey | NGEXKODHLFEXOX-RXIOLPMVSA-N |
| XLogP | 4.79 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|