C24H38O7 — CID 177495514
methyl 9-[(2R,3R,4S,5S,6S)-3-hydroxy-4-methoxy-6-methyl-5-phenylmethoxyoxan-2-yl]oxynonanoate (PubChem CID 177495514) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is methyl 9-[(2R,3R,4S,5S,6S)-3-hydroxy-4-methoxy-6-methyl-5-phenylmethoxyoxan-2-yl]oxynonanoate.
| Compound Name | methyl 9-[(2R,3R,4S,5S,6S)-3-hydroxy-4-methoxy-6-methyl-5-phenylmethoxyoxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 177495514 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | methyl 9-[(2R,3R,4S,5S,6S)-3-hydroxy-4-methoxy-6-methyl-5-phenylmethoxyoxan-2-yl]oxynonanoate |
| SMILES | COC(=O)CCCCCCCCO[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OC)[C@H]1O |
| InChI | InChI=1S/C24H38O7/c1-18-22(30-17-19-13-9-8-10-14-19)23(28-3)21(26)24(31-18)29-16-12-7-5-4-6-11-15-20(25)27-2/h8-10,13-14,18,21-24,26H,4-7,11-12,15-17H2,1-3H3/t18-,21+,22-,23-,24+/m0/s1 |
| InChIKey | CGAOGCCSUBSWSQ-PIAWWSJMSA-N |
| XLogP | 3.61 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|