C33H41ClO5 — CID 10099141
(2S,3S,4R,5R,6S)-2-(6-chlorohexoxy)-6-methyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 10099141) has the molecular formula C33H41ClO5 and a molecular weight of 553.14 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-(6-chlorohexoxy)-6-methyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3S,4R,5R,6S)-2-(6-chlorohexoxy)-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 10099141 |
| Molecular Formula | C33H41ClO5 |
| Molecular Weight | 553.14 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-(6-chlorohexoxy)-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | C[C@@H]1O[C@H](OCCCCCCCl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H41ClO5/c1-26-30(36-23-27-15-7-4-8-16-27)31(37-24-28-17-9-5-10-18-28)32(38-25-29-19-11-6-12-20-29)33(39-26)35-22-14-3-2-13-21-34/h4-12,15-20,26,30-33H,2-3,13-14,21-25H2,1H3/t26-,30+,31+,32-,33-/m0/s1 |
| InChIKey | XZAZLWRWCGBCAL-UGNQTYMGSA-N |
| XLogP | 7.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.14 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|