C41H47NO8 — CID 102014544
4-[6-[(3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexylcarbamoyl]benzoic acid (PubChem CID 102014544) has the molecular formula C41H47NO8 and a molecular weight of 681.83 g/mol. Its IUPAC name is 4-[6-[(3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexylcarbamoyl]benzoic acid.
| Compound Name | 4-[6-[(3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 102014544 |
| Molecular Formula | C41H47NO8 |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | 4-[6-[(3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexylcarbamoyl]benzoic acid |
| SMILES | C[C@@H]1OC(OCCCCCCNC(=O)c2ccc(C(=O)O)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H47NO8/c1-30-36(47-27-31-15-7-4-8-16-31)37(48-28-32-17-9-5-10-18-32)38(49-29-33-19-11-6-12-20-33)41(50-30)46-26-14-3-2-13-25-42-39(43)34-21-23-35(24-22-34)40(44)45/h4-12,15-24,30,36-38,41H,2-3,13-14,25-29H2,1H3,(H,42,43)(H,44,45)/t30-,36+,37+,38-,41?/m0/s1 |
| InChIKey | BZJIDTVQQNYGTE-ZRSTWPSLSA-N |
| XLogP | 7.19 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|