C33H40O6 — CID 101385831
6-[(2R,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexanal (PubChem CID 101385831) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is 6-[(2R,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexanal.
| Compound Name | 6-[(2R,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexanal |
|---|---|
| PubChem CID | 101385831 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 6-[(2R,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyhexanal |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H40O6/c1-26-30(36-23-27-15-7-4-8-16-27)31(37-24-28-17-9-5-10-18-28)32(38-25-29-19-11-6-12-20-29)33(39-26)35-22-14-3-2-13-21-34/h4-12,15-21,26,30-33H,2-3,13-14,22-25H2,1H3/t26-,30+,31+,32-,33+/m0/s1 |
| InChIKey | PODCWOBQVWWFFX-GXCPKCQMSA-N |
| XLogP | 6.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|