C35H45NO7 — CID 18970877
N-[6-[2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyhexyl]acetamide (PubChem CID 18970877) has the molecular formula C35H45NO7 and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[6-[2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyhexyl]acetamide.
| Compound Name | N-[6-[2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyhexyl]acetamide |
|---|---|
| PubChem CID | 18970877 |
| Molecular Formula | C35H45NO7 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | N-[6-[2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyhexyl]acetamide |
| SMILES | CC(=O)NCCCCCCOC1C(O)C(O)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C35H45NO7/c1-26(37)36-21-13-2-3-14-22-40-32-30(38)31(39)33(41-23-27-15-7-4-8-16-27)35(43-25-29-19-11-6-12-20-29)34(32)42-24-28-17-9-5-10-18-28/h4-12,15-20,30-35,38-39H,2-3,13-14,21-25H2,1H3,(H,36,37) |
| InChIKey | KOOYUUAWJMTGKU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|