C46H56N2O7 — CID 54084073
N-[7-[3-ethoxy-2-hydroxy-3-(1H-indol-3-yl)-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide (PubChem CID 54084073) has the molecular formula C46H56N2O7 and a molecular weight of 748.96 g/mol. Its IUPAC name is N-[7-[3-ethoxy-2-hydroxy-3-(1H-indol-3-yl)-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide.
| Compound Name | N-[7-[3-ethoxy-2-hydroxy-3-(1H-indol-3-yl)-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide |
|---|---|
| PubChem CID | 54084073 |
| Molecular Formula | C46H56N2O7 |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.41 |
| IUPAC Name | N-[7-[3-ethoxy-2-hydroxy-3-(1H-indol-3-yl)-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide |
| SMILES | CCOC1(c2c[nH]c3ccccc23)C(O)C(OCCCCCCCNC(C)=O)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C46H56N2O7/c1-3-55-46(39-30-48-40-27-17-16-26-38(39)40)44(50)42(51-29-19-6-4-5-18-28-47-34(2)49)41(52-31-35-20-10-7-11-21-35)43(53-32-36-22-12-8-13-23-36)45(46)54-33-37-24-14-9-15-25-37/h7-17,20-27,30,41-45,48,50H,3-6,18-19,28-29,31-33H2,1-2H3,(H,47,49) |
| InChIKey | MPEIBLUGMTZPPZ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|