C29H40N2O6 — CID 18970855
3-(6-aminohexoxy)-5-[1-(1H-indol-3-yl)ethoxy]-6-phenylmethoxycyclohexane-1,2,4-triol (PubChem CID 18970855) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-(6-aminohexoxy)-5-[1-(1H-indol-3-yl)ethoxy]-6-phenylmethoxycyclohexane-1,2,4-triol.
| Compound Name | 3-(6-aminohexoxy)-5-[1-(1H-indol-3-yl)ethoxy]-6-phenylmethoxycyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 18970855 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 3-(6-aminohexoxy)-5-[1-(1H-indol-3-yl)ethoxy]-6-phenylmethoxycyclohexane-1,2,4-triol |
| SMILES | CC(OC1C(O)C(OCCCCCCN)C(O)C(O)C1OCc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H40N2O6/c1-19(22-17-31-23-14-8-7-13-21(22)23)37-29-26(34)27(35-16-10-3-2-9-15-30)24(32)25(33)28(29)36-18-20-11-5-4-6-12-20/h4-8,11-14,17,19,24-29,31-34H,2-3,9-10,15-16,18,30H2,1H3 |
| InChIKey | GKKVAZZJPBOPRK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|