C46H48N2O7 — CID 165111734
N-[2-[5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]acetamide (PubChem CID 165111734) has the molecular formula C46H48N2O7 and a molecular weight of 740.90 g/mol. Its IUPAC name is N-[2-[5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 165111734 |
| Molecular Formula | C46H48N2O7 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.35 |
| IUPAC Name | N-[2-[5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(O[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)cc12 |
| InChI | InChI=1S/C46H48N2O7/c1-33(49)47-25-24-38-27-48-41-23-22-39(26-40(38)41)54-46-45(53-31-37-20-12-5-13-21-37)44(52-30-36-18-10-4-11-19-36)43(51-29-35-16-8-3-9-17-35)42(55-46)32-50-28-34-14-6-2-7-15-34/h2-23,26-27,42-46,48H,24-25,28-32H2,1H3,(H,47,49)/t42-,43-,44+,45-,46+/m1/s1 |
| InChIKey | KJPKXOJKANKIIB-PSKPMRIASA-N |
| XLogP | 7.92 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |