C40H43N2O12P — CID 165111726
[(2S,3R,4S,5R,6R)-2-[[3-(2-acetamidoethyl)-1H-indol-5-yl]oxy]-4-bis(phenylmethoxy)phosphoryloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] benzyl carbonate (PubChem CID 165111726) has the molecular formula C40H43N2O12P and a molecular weight of 774.76 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-[[3-(2-acetamidoethyl)-1H-indol-5-yl]oxy]-4-bis(phenylmethoxy)phosphoryloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] benzyl carbonate.
| Compound Name | [(2S,3R,4S,5R,6R)-2-[[3-(2-acetamidoethyl)-1H-indol-5-yl]oxy]-4-bis(phenylmethoxy)phosphoryloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] benzyl carbonate |
|---|---|
| PubChem CID | 165111726 |
| Molecular Formula | C40H43N2O12P |
| Molecular Weight | 774.76 g/mol |
| Exact Mass | 774.26 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-[[3-(2-acetamidoethyl)-1H-indol-5-yl]oxy]-4-bis(phenylmethoxy)phosphoryloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] benzyl carbonate |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](OP(=O)(OCc4ccccc4)OCc4ccccc4)[C@H]3OC(=O)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C40H43N2O12P/c1-27(44)41-20-19-31-22-42-34-18-17-32(21-33(31)34)51-39-38(53-40(46)48-24-28-11-5-2-6-12-28)37(36(45)35(23-43)52-39)54-55(47,49-25-29-13-7-3-8-14-29)50-26-30-15-9-4-10-16-30/h2-18,21-22,35-39,42-43,45H,19-20,23-26H2,1H3,(H,41,44)/t35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | DRQAPSBBRTWXPR-GFRPZHATSA-N |
| XLogP | 5.95 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.76 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|