C30H32N3O6P — CID 170173353
dibenzyl [3-[2-[(2-oxopiperidine-3-carbonyl)amino]ethyl]-1H-indol-5-yl] phosphate (PubChem CID 170173353) has the molecular formula C30H32N3O6P and a molecular weight of 561.58 g/mol. Its IUPAC name is dibenzyl [3-[2-[(2-oxopiperidine-3-carbonyl)amino]ethyl]-1H-indol-5-yl] phosphate.
| Compound Name | dibenzyl [3-[2-[(2-oxopiperidine-3-carbonyl)amino]ethyl]-1H-indol-5-yl] phosphate |
|---|---|
| PubChem CID | 170173353 |
| Molecular Formula | C30H32N3O6P |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | dibenzyl [3-[2-[(2-oxopiperidine-3-carbonyl)amino]ethyl]-1H-indol-5-yl] phosphate |
| SMILES | O=C1NCCCC1C(=O)NCCc1c[nH]c2ccc(OP(=O)(OCc3ccccc3)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C30H32N3O6P/c34-29-26(12-7-16-31-29)30(35)32-17-15-24-19-33-28-14-13-25(18-27(24)28)39-40(36,37-20-22-8-3-1-4-9-22)38-21-23-10-5-2-6-11-23/h1-6,8-11,13-14,18-19,26,33H,7,12,15-17,20-21H2,(H,31,34)(H,32,35) |
| InChIKey | CDZCGXPPCWFYBI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|