C25H26N2O4 — CID 164616693
(3E)-3-[(4-hydroxyphenyl)methylidene]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxocyclohexane-1-carboxamide (PubChem CID 164616693) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (3E)-3-[(4-hydroxyphenyl)methylidene]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxocyclohexane-1-carboxamide.
| Compound Name | (3E)-3-[(4-hydroxyphenyl)methylidene]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 164616693 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (3E)-3-[(4-hydroxyphenyl)methylidene]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxocyclohexane-1-carboxamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)C3CCC/C(=C\c4ccc(O)cc4)C3=O)c2c1 |
| InChI | InChI=1S/C25H26N2O4/c1-31-20-9-10-23-22(14-20)18(15-27-23)11-12-26-25(30)21-4-2-3-17(24(21)29)13-16-5-7-19(28)8-6-16/h5-10,13-15,21,27-28H,2-4,11-12H2,1H3,(H,26,30)/b17-13+ |
| InChIKey | NZNHUHTZIXVHKN-GHRIWEEISA-N |
| XLogP | 3.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|