C40H43NO8 — CID 67662095
2-[5-[(1S,2S,3R,4S,5R,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxypentyl]isoindole-1,3-dione (PubChem CID 67662095) has the molecular formula C40H43NO8 and a molecular weight of 665.78 g/mol. Its IUPAC name is 2-[5-[(1S,2S,3R,4S,5R,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxypentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[(1S,2S,3R,4S,5R,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxypentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67662095 |
| Molecular Formula | C40H43NO8 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | 2-[5-[(1S,2S,3R,4S,5R,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxypentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCO[C@H]1[C@@H](O)[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H43NO8/c42-33-34(43)36(47-25-28-15-5-1-6-16-28)38(49-27-30-19-9-3-10-20-30)37(48-26-29-17-7-2-8-18-29)35(33)46-24-14-4-13-23-41-39(44)31-21-11-12-22-32(31)40(41)45/h1-3,5-12,15-22,33-38,42-43H,4,13-14,23-27H2/t33-,34+,35-,36-,37+,38+/m0/s1 |
| InChIKey | UHKLZAUVUQAAAK-TVSIWPERSA-N |
| XLogP | 5.33 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|