C30H35NO5 — CID 155415771
N-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide (PubChem CID 155415771) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide.
| Compound Name | N-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 155415771 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1OC(C)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H35NO5/c1-22-28(33-19-24-12-6-3-7-13-24)30(35-21-26-16-10-5-11-17-26)29(27(36-22)18-31-23(2)32)34-20-25-14-8-4-9-15-25/h3-17,22,27-30H,18-21H2,1-2H3,(H,31,32) |
| InChIKey | GJFGBAHOBACIHG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |