C28H32O5 — CID 170405483
[(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 170405483) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 170405483 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | C[C@@H]1O[C@@H](CO)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H32O5/c1-21-26(30-18-22-11-5-2-6-12-22)28(32-20-24-15-9-4-10-16-24)27(25(17-29)33-21)31-19-23-13-7-3-8-14-23/h2-16,21,25-29H,17-20H2,1H3/t21-,25-,26-,27-,28+/m0/s1 |
| InChIKey | GFUNCYUGRANXPO-BXKOSDMPSA-N |
| XLogP | 4.52 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |