C20H23BrO4 — CID 13009797
[(2R,3R,4S,5R)-5-(bromomethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (PubChem CID 13009797) has the molecular formula C20H23BrO4 and a molecular weight of 407.30 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(bromomethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R)-5-(bromomethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 13009797 |
| Molecular Formula | C20H23BrO4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(bromomethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](CBr)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H23BrO4/c21-11-17-19(23-13-15-7-3-1-4-8-15)20(18(12-22)25-17)24-14-16-9-5-2-6-10-16/h1-10,17-20,22H,11-14H2/t17-,18+,19+,20+/m0/s1 |
| InChIKey | IZUNLTZYUIRHKJ-MTQWCTHYSA-N |
| XLogP | 3.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|