C29H34O6S — CID 102092355
(2S,3R,4R,5S,6S)-2-methyl-6-(methylsulfonylmethyl)-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 102092355) has the molecular formula C29H34O6S and a molecular weight of 510.65 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-methyl-6-(methylsulfonylmethyl)-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4R,5S,6S)-2-methyl-6-(methylsulfonylmethyl)-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 102092355 |
| Molecular Formula | C29H34O6S |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-methyl-6-(methylsulfonylmethyl)-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | C[C@@H]1O[C@H](CS(C)(=O)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O6S/c1-22-27(32-18-23-12-6-3-7-13-23)29(34-20-25-16-10-5-11-17-25)28(26(35-22)21-36(2,30)31)33-19-24-14-8-4-9-15-24/h3-17,22,26-29H,18-21H2,1-2H3/t22-,26+,27+,28+,29+/m0/s1 |
| InChIKey | RAKATTOHSBJKTL-UKWJTHFESA-N |
| XLogP | 4.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |