C33H34O6S — CID 102061085
(2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-6-methyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 102061085) has the molecular formula C33H34O6S and a molecular weight of 558.70 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-6-methyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 102061085 |
| Molecular Formula | C33H34O6S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | C[C@H]1O[C@@H](S(=O)(=O)c2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H34O6S/c1-25-30(36-22-26-14-6-2-7-15-26)31(37-23-27-16-8-3-9-17-27)32(38-24-28-18-10-4-11-19-28)33(39-25)40(34,35)29-20-12-5-13-21-29/h2-21,25,30-33H,22-24H2,1H3/t25-,30-,31+,32-,33+/m1/s1 |
| InChIKey | GDERFVJPXTYQDP-HPDOISGISA-N |
| XLogP | 5.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |