C21H27NO5 — CID 130316142
2-[(hydroxyamino)methyl]-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol (PubChem CID 130316142) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[(hydroxyamino)methyl]-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol.
| Compound Name | 2-[(hydroxyamino)methyl]-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol |
|---|---|
| PubChem CID | 130316142 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[(hydroxyamino)methyl]-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol |
| SMILES | CC1OC(CNO)C(OCc2ccccc2)C(O)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO5/c1-15-20(25-13-16-8-4-2-5-9-16)19(23)21(18(27-15)12-22-24)26-14-17-10-6-3-7-11-17/h2-11,15,18-24H,12-14H2,1H3 |
| InChIKey | RBFRQZKXYOARHG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|