C32H43NO9 — CID 11706955
methyl 6-[(2S,3S,4S,5R,6R)-3-methoxy-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-2-yl]oxyhexanoate (PubChem CID 11706955) has the molecular formula C32H43NO9 and a molecular weight of 585.69 g/mol. Its IUPAC name is methyl 6-[(2S,3S,4S,5R,6R)-3-methoxy-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[(2S,3S,4S,5R,6R)-3-methoxy-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 11706955 |
| Molecular Formula | C32H43NO9 |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | methyl 6-[(2S,3S,4S,5R,6R)-3-methoxy-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-2-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCO[C@H]1O[C@H](C)[C@@H](NC(=O)[C@H]2CCO[C@@H](c3ccccc3)O2)[C@H](OCc2ccccc2)[C@@H]1OC |
| InChI | InChI=1S/C32H43NO9/c1-22-27(33-30(35)25-18-20-39-31(42-25)24-15-9-5-10-16-24)28(40-21-23-13-7-4-8-14-23)29(37-3)32(41-22)38-19-12-6-11-17-26(34)36-2/h4-5,7-10,13-16,22,25,27-29,31-32H,6,11-12,17-21H2,1-3H3,(H,33,35)/t22-,25-,27-,28+,29+,31-,32+/m1/s1 |
| InChIKey | DZFHGKUPTLWUQU-JZCRBRQYSA-N |
| XLogP | 4.07 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|