C43H50O10 — CID 129142278
methyl (5R,6S)-8-[[(6S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-5-hydroxy-6-phenylmethoxyoctanoate (PubChem CID 129142278) has the molecular formula C43H50O10 and a molecular weight of 726.86 g/mol. Its IUPAC name is methyl (5R,6S)-8-[[(6S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-5-hydroxy-6-phenylmethoxyoctanoate.
| Compound Name | methyl (5R,6S)-8-[[(6S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-5-hydroxy-6-phenylmethoxyoctanoate |
|---|---|
| PubChem CID | 129142278 |
| Molecular Formula | C43H50O10 |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | methyl (5R,6S)-8-[[(6S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-5-hydroxy-6-phenylmethoxyoctanoate |
| SMILES | COC(=O)CCC[C@@H](O)[C@H](CCO[C@H]1OC2COC(c3ccccc3)O[C@@H]2C(OCc2ccccc2)C1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C43H50O10/c1-46-38(45)24-14-23-35(44)36(48-27-31-15-6-2-7-16-31)25-26-47-43-41(50-29-33-19-10-4-11-20-33)40(49-28-32-17-8-3-9-18-32)39-37(52-43)30-51-42(53-39)34-21-12-5-13-22-34/h2-13,15-22,35-37,39-44H,14,23-30H2,1H3/t35-,36+,37?,39+,40?,41?,42?,43+/m1/s1 |
| InChIKey | PPPJTGQKLVQVSF-LIWLZDHBSA-N |
| XLogP | 6.69 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |