C28H35NO7S — CID 44631636
[(3S,4S,5R,6R)-2-ethylsulfanyl-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 44631636) has the molecular formula C28H35NO7S and a molecular weight of 529.66 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-2-ethylsulfanyl-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-2-ethylsulfanyl-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 44631636 |
| Molecular Formula | C28H35NO7S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [(3S,4S,5R,6R)-2-ethylsulfanyl-6-methyl-5-[[(2R,4R)-2-phenyl-1,3-dioxane-4-carbonyl]amino]-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CCSC1O[C@H](C)[C@@H](NC(=O)[C@H]2CCO[C@@H](c3ccccc3)O2)[C@H](OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H35NO7S/c1-4-37-28-25(35-19(3)30)24(33-17-20-11-7-5-8-12-20)23(18(2)34-28)29-26(31)22-15-16-32-27(36-22)21-13-9-6-10-14-21/h5-14,18,22-25,27-28H,4,15-17H2,1-3H3,(H,29,31)/t18-,22-,23-,24+,25+,27-,28?/m1/s1 |
| InChIKey | MJZXMKJMPDLSIB-UJQFNZNMSA-N |
| XLogP | 3.99 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |