C32H49NO9S3 — CID 11520401
[(2R,3S,4S,5R,6R)-5-[[(2R)-2,4-diacetyloxybutanoyl]amino]-2-ethylsulfanyl-6-methyl-4-phenylmethoxyoxan-3-yl] 4,4-bis(ethylsulfanyl)pentanoate (PubChem CID 11520401) has the molecular formula C32H49NO9S3 and a molecular weight of 687.94 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-[[(2R)-2,4-diacetyloxybutanoyl]amino]-2-ethylsulfanyl-6-methyl-4-phenylmethoxyoxan-3-yl] 4,4-bis(ethylsulfanyl)pentanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-[[(2R)-2,4-diacetyloxybutanoyl]amino]-2-ethylsulfanyl-6-methyl-4-phenylmethoxyoxan-3-yl] 4,4-bis(ethylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 11520401 |
| Molecular Formula | C32H49NO9S3 |
| Molecular Weight | 687.94 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-[[(2R)-2,4-diacetyloxybutanoyl]amino]-2-ethylsulfanyl-6-methyl-4-phenylmethoxyoxan-3-yl] 4,4-bis(ethylsulfanyl)pentanoate |
| SMILES | CCS[C@H]1O[C@H](C)[C@@H](NC(=O)[C@@H](CCOC(C)=O)OC(C)=O)[C@H](OCc2ccccc2)[C@@H]1OC(=O)CCC(C)(SCC)SCC |
| InChI | InChI=1S/C32H49NO9S3/c1-8-43-31-29(42-26(36)16-18-32(7,44-9-2)45-10-3)28(39-20-24-14-12-11-13-15-24)27(21(4)40-31)33-30(37)25(41-23(6)35)17-19-38-22(5)34/h11-15,21,25,27-29,31H,8-10,16-20H2,1-7H3,(H,33,37)/t21-,25-,27-,28+,29+,31-/m1/s1 |
| InChIKey | HKSWZGSORPRXHS-MEDNWKSCSA-N |
| XLogP | 5.35 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|