C25H30O7S — CID 10322670
methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-ethylsulfanyl-3,4-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 10322670) has the molecular formula C25H30O7S and a molecular weight of 474.58 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-ethylsulfanyl-3,4-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-ethylsulfanyl-3,4-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 10322670 |
| Molecular Formula | C25H30O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-5-acetyloxy-6-ethylsulfanyl-3,4-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CCS[C@@H]1O[C@H](C(=O)OC)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H30O7S/c1-4-33-25-23(31-17(2)26)21(30-16-19-13-9-6-10-14-19)20(22(32-25)24(27)28-3)29-15-18-11-7-5-8-12-18/h5-14,20-23,25H,4,15-16H2,1-3H3/t20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | ATQWEUSDFRGAJT-WHGMEAMLSA-N |
| XLogP | 3.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |