C38H38O8S — CID 101383912
methyl (2R,3S,4S,5R,6S)-6-ethylsulfanyl-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 101383912) has the molecular formula C38H38O8S and a molecular weight of 654.78 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R,6S)-6-ethylsulfanyl-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R,6S)-6-ethylsulfanyl-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 101383912 |
| Molecular Formula | C38H38O8S |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | methyl (2R,3S,4S,5R,6S)-6-ethylsulfanyl-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CCS[C@@H]1O[C@@H](C(=O)OC)[C@@H](OC(=O)OCC2c3ccccc3-c3ccccc32)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H38O8S/c1-3-47-37-35(43-23-26-16-8-5-9-17-26)32(42-22-25-14-6-4-7-15-25)33(34(45-37)36(39)41-2)46-38(40)44-24-31-29-20-12-10-18-27(29)28-19-11-13-21-30(28)31/h4-21,31-35,37H,3,22-24H2,1-2H3/t32-,33-,34+,35+,37-/m0/s1 |
| InChIKey | OUBGYHHBAHLBTG-DOURSOTQSA-N |
| XLogP | 7.14 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |