C36H34O8 — CID 11456129
[(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate (PubChem CID 11456129) has the molecular formula C36H34O8 and a molecular weight of 594.66 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate |
|---|---|
| PubChem CID | 11456129 |
| Molecular Formula | C36H34O8 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=O)OCC2c3ccccc3-c3ccccc32)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H34O8/c1-38-35-33(39-20-23-12-4-2-5-13-23)32(31-30(42-35)22-40-34(43-31)24-14-6-3-7-15-24)44-36(37)41-21-29-27-18-10-8-16-25(27)26-17-9-11-19-28(26)29/h2-19,29-35H,20-22H2,1H3/t30-,31-,32+,33-,34-,35+/m1/s1 |
| InChIKey | ZINQXCAGCWITDG-RFQHCYMRSA-N |
| XLogP | 6.39 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |