C29H28O6 — CID 59142010
9H-fluoren-9-ylmethyl [(8R)-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] carbonate (PubChem CID 59142010) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl [(8R)-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] carbonate.
| Compound Name | 9H-fluoren-9-ylmethyl [(8R)-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] carbonate |
|---|---|
| PubChem CID | 59142010 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl [(8R)-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] carbonate |
| SMILES | CC1COC2COC(c3ccccc3)OC2[C@@H]1OC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H28O6/c1-18-15-31-25-17-32-28(19-9-3-2-4-10-19)34-27(25)26(18)35-29(30)33-16-24-22-13-7-5-11-20(22)21-12-6-8-14-23(21)24/h2-14,18,24-28H,15-17H2,1H3/t18?,25?,26-,27?,28?/m1/s1 |
| InChIKey | DEODMHKJGKLTNL-LMMOBPLSSA-N |
| XLogP | 5.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |