C24H27NO6 — CID 102411103
[(4aR,7S,8R,8aS)-7-acetamido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenylpropanoate (PubChem CID 102411103) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(4aR,7S,8R,8aS)-7-acetamido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenylpropanoate.
| Compound Name | [(4aR,7S,8R,8aS)-7-acetamido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 102411103 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [(4aR,7S,8R,8aS)-7-acetamido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenylpropanoate |
| SMILES | CC(=O)N[C@H]1CO[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C24H27NO6/c1-16(26)25-19-14-28-20-15-29-24(18-10-6-3-7-11-18)31-23(20)22(19)30-21(27)13-12-17-8-4-2-5-9-17/h2-11,19-20,22-24H,12-15H2,1H3,(H,25,26)/t19-,20+,22+,23+,24?/m0/s1 |
| InChIKey | GOLGOXGMAWBILJ-IAKFFBQLSA-N |
| XLogP | 2.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |