C24H27NO8 — CID 70626844
[(4aR,6S,7R,8R,8aS)-7-acetamido-6-methyl-2-phenyl-6-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] hydrogen carbonate (PubChem CID 70626844) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7-acetamido-6-methyl-2-phenyl-6-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] hydrogen carbonate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7-acetamido-6-methyl-2-phenyl-6-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70626844 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7-acetamido-6-methyl-2-phenyl-6-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] hydrogen carbonate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(=O)O)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@]1(C)OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO8/c1-15(26)25-21-20(32-23(27)28)19-18(14-29-22(31-19)17-11-7-4-8-12-17)33-24(21,2)30-13-16-9-5-3-6-10-16/h3-12,18-22H,13-14H2,1-2H3,(H,25,26)(H,27,28)/t18-,19-,20+,21-,22?,24+/m1/s1 |
| InChIKey | XHZCPMSIRISRFK-FYWLPIKUSA-N |
| XLogP | 3.00 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |