C29H29NO6 — CID 70877957
[(8R,8aS)-7-acetamido-6-benzyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 70877957) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is [(8R,8aS)-7-acetamido-6-benzyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(8R,8aS)-7-acetamido-6-benzyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 70877957 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(8R,8aS)-7-acetamido-6-benzyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | CC(=O)NC1C(Cc2ccccc2)OC2COC(c3ccccc3)O[C@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29NO6/c1-19(31)30-25-23(17-20-11-5-2-6-12-20)34-24-18-33-29(22-15-9-4-10-16-22)36-26(24)27(25)35-28(32)21-13-7-3-8-14-21/h2-16,23-27,29H,17-18H2,1H3,(H,30,31)/t23?,24?,25?,26-,27-,29?/m1/s1 |
| InChIKey | KYQRHGGLDHSNBB-KCQWGEPSSA-N |
| XLogP | 3.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |