C33H32Cl3NO8S — CID 11061525
[(2R,4aR,6R,7R,8R,8aS)-6-ethylsulfanyl-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate (PubChem CID 11061525) has the molecular formula C33H32Cl3NO8S and a molecular weight of 709.04 g/mol. Its IUPAC name is [(2R,4aR,6R,7R,8R,8aS)-6-ethylsulfanyl-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate.
| Compound Name | [(2R,4aR,6R,7R,8R,8aS)-6-ethylsulfanyl-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate |
|---|---|
| PubChem CID | 11061525 |
| Molecular Formula | C33H32Cl3NO8S |
| Molecular Weight | 709.04 g/mol |
| Exact Mass | 707.09 |
| IUPAC Name | [(2R,4aR,6R,7R,8R,8aS)-6-ethylsulfanyl-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 9H-fluoren-9-ylmethyl carbonate |
| SMILES | CCS[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=O)OCC2c3ccccc3-c3ccccc32)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H32Cl3NO8S/c1-2-46-30-26(37-31(38)42-18-33(34,35)36)28(27-25(43-30)17-40-29(44-27)19-10-4-3-5-11-19)45-32(39)41-16-24-22-14-8-6-12-20(22)21-13-7-9-15-23(21)24/h3-15,24-30H,2,16-18H2,1H3,(H,37,38)/t25-,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | RQDSYETZMIIDGC-VHNXJUCRSA-N |
| XLogP | 7.38 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|