C26H24Cl3NO6S — CID 102490432
2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-naphthalen-1-ylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 102490432) has the molecular formula C26H24Cl3NO6S and a molecular weight of 584.91 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-naphthalen-1-ylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-naphthalen-1-ylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 102490432 |
| Molecular Formula | C26H24Cl3NO6S |
| Molecular Weight | 584.91 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-6-naphthalen-1-ylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | O=C(N[C@@H]1[C@@H](O)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@H]1Sc1cccc2ccccc12)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H24Cl3NO6S/c27-26(28,29)14-34-25(32)30-20-21(31)22-18(13-33-23(36-22)16-8-2-1-3-9-16)35-24(20)37-19-12-6-10-15-7-4-5-11-17(15)19/h1-12,18,20-24,31H,13-14H2,(H,30,32)/t18-,20-,21-,22-,23?,24+/m1/s1 |
| InChIKey | DOXIPLDGCJIAKY-WGADNOCBSA-N |
| XLogP | 5.60 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|