C21H23NO7 — CID 56606104
[deuterio(phenyl)methyl] N-[(4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 56606104) has the molecular formula C21H23NO7 and a molecular weight of 402.42 g/mol. Its IUPAC name is [deuterio(phenyl)methyl] N-[(4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | [deuterio(phenyl)methyl] N-[(4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 56606104 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [deuterio(phenyl)methyl] N-[(4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | [2H]C(OC(=O)N[C@H]1C(O)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO7/c23-17-16(22-21(25)27-11-13-7-3-1-4-8-13)19(24)28-15-12-26-20(29-18(15)17)14-9-5-2-6-10-14/h1-10,15-20,23-24H,11-12H2,(H,22,25)/t15-,16-,17-,18-,19?,20?/m1/s1/i11D/t11?,15-,16-,17-,18-,19?,20? |
| InChIKey | LGNWNHKHCNFYMJ-HMBUAGSKSA-N |
| XLogP | 1.47 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |