C17H18Cl3NO6 — CID 118450137
2,2,2-trichloroethyl 2-[(3S,7S)-6-hydroxy-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-4-yl]acetate (PubChem CID 118450137) has the molecular formula C17H18Cl3NO6 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(3S,7S)-6-hydroxy-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-4-yl]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[(3S,7S)-6-hydroxy-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-4-yl]acetate |
|---|---|
| PubChem CID | 118450137 |
| Molecular Formula | C17H18Cl3NO6 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(3S,7S)-6-hydroxy-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-4-yl]acetate |
| SMILES | O=C(CN1C2C(O)[C@@H]3OC(c4ccccc4)OCC3O[C@@H]21)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H18Cl3NO6/c18-17(19,20)8-25-11(22)6-21-12-13(23)14-10(26-15(12)21)7-24-16(27-14)9-4-2-1-3-5-9/h1-5,10,12-16,23H,6-8H2/t10?,12?,13?,14-,15+,16?,21?/m1/s1 |
| InChIKey | CMAORHNCBZMNCB-VVVFVGPPSA-N |
| XLogP | 1.78 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|